C15H9F3 — CID 21095845
1-(2,3,4-trifluorophenyl)-1H-indene (PubChem CID 21095845) has the molecular formula C15H9F3 and a molecular weight of 246.23 g/mol. Its IUPAC name is 1-(2,3,4-trifluorophenyl)-1H-indene.
| Compound Name | 1-(2,3,4-trifluorophenyl)-1H-indene |
|---|---|
| PubChem CID | 21095845 |
| Molecular Formula | C15H9F3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 1-(2,3,4-trifluorophenyl)-1H-indene |
| SMILES | Fc1ccc(C2C=Cc3ccccc32)c(F)c1F |
| InChI | InChI=1S/C15H9F3/c16-13-8-7-12(14(17)15(13)18)11-6-5-9-3-1-2-4-10(9)11/h1-8,11H |
| InChIKey | OHRQTMXFVUBRTC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|