C17H17F3N2O4S — CID 174711745
[4-[2-[2-(2-methoxy-2-oxoethyl)phenyl]ethyl]-5-(trifluoromethyl)pyrimidin-2-yl]methanesulfinic acid (PubChem CID 174711745) has the molecular formula C17H17F3N2O4S and a molecular weight of 402.39 g/mol. Its IUPAC name is [4-[2-[2-(2-methoxy-2-oxoethyl)phenyl]ethyl]-5-(trifluoromethyl)pyrimidin-2-yl]methanesulfinic acid.
| Compound Name | [4-[2-[2-(2-methoxy-2-oxoethyl)phenyl]ethyl]-5-(trifluoromethyl)pyrimidin-2-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 174711745 |
| Molecular Formula | C17H17F3N2O4S |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | [4-[2-[2-(2-methoxy-2-oxoethyl)phenyl]ethyl]-5-(trifluoromethyl)pyrimidin-2-yl]methanesulfinic acid |
| SMILES | COC(=O)Cc1ccccc1CCc1nc(CS(=O)O)ncc1C(F)(F)F |
| InChI | InChI=1S/C17H17F3N2O4S/c1-26-16(23)8-12-5-3-2-4-11(12)6-7-14-13(17(18,19)20)9-21-15(22-14)10-27(24)25/h2-5,9H,6-8,10H2,1H3,(H,24,25) |
| InChIKey | CJGUSGAUMVKBGS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|