C28H29BF3N4O3 — CID 159459135
CID 159459135 (PubChem CID 159459135) has the molecular formula C28H29BF3N4O3 and a molecular weight of 537.37 g/mol.
| Compound Name | CID 159459135 |
|---|---|
| PubChem CID | 159459135 |
| Molecular Formula | C28H29BF3N4O3 |
| Molecular Weight | 537.37 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | — |
| SMILES | COC(=O)Cc1ccccc1CCc1nc(Cc2ccc(N3CCN([B]C=O)CC3)cc2)ncc1C(F)(F)F |
| InChI | InChI=1S/C28H29BF3N4O3/c1-39-27(38)17-22-5-3-2-4-21(22)8-11-25-24(28(30,31)32)18-33-26(34-25)16-20-6-9-23(10-7-20)35-12-14-36(15-13-35)29-19-37/h2-7,9-10,18-19H,8,11-17H2,1H3 |
| InChIKey | KKQWFNWBKLCODQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|