C26H27BF3N6O2 — CID 158176669
CID 158176669 (PubChem CID 158176669) has the molecular formula C26H27BF3N6O2 and a molecular weight of 523.35 g/mol.
| Compound Name | CID 158176669 |
|---|---|
| PubChem CID | 158176669 |
| Molecular Formula | C26H27BF3N6O2 |
| Molecular Weight | 523.35 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | — |
| SMILES | NC(=O)Cc1cncnc1CCc1nc(Cc2ccc(C3CCN([B]C=O)CC3)cc2)ncc1C(F)(F)F |
| InChI | InChI=1S/C26H27BF3N6O2/c28-26(29,30)21-14-33-25(35-23(21)6-5-22-20(12-24(31)38)13-32-16-34-22)11-17-1-3-18(4-2-17)19-7-9-36(10-8-19)27-15-37/h1-4,13-16,19H,5-12H2,(H2,31,38) |
| InChIKey | AEHSRXJHVALGGY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|