C22H35N5O3 — CID 174713468
tert-butyl formate;N-butyl-N-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]piperidin-4-amine (PubChem CID 174713468) has the molecular formula C22H35N5O3 and a molecular weight of 417.55 g/mol. Its IUPAC name is tert-butyl formate;N-butyl-N-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]piperidin-4-amine.
| Compound Name | tert-butyl formate;N-butyl-N-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 174713468 |
| Molecular Formula | C22H35N5O3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | tert-butyl formate;N-butyl-N-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]piperidin-4-amine |
| SMILES | CC(C)(C)OC=O.CCCCN(Cc1nc(-c2ccncc2)no1)C1CCNCC1 |
| InChI | InChI=1S/C17H25N5O.C5H10O2/c1-2-3-12-22(15-6-10-19-11-7-15)13-16-20-17(21-23-16)14-4-8-18-9-5-14;1-5(2,3)7-4-6/h4-5,8-9,15,19H,2-3,6-7,10-13H2,1H3;4H,1-3H3 |
| InChIKey | QQQQTLWAOPYBEW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 93.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|