C21H15Cl2N2O6S- — CID 174713766
[3-chloro-4-[[4-chloro-3-(5-methoxycarbonyl-2-pyridinyl)phenyl]carbamoyl]phenyl]methyl sulfite (PubChem CID 174713766) has the molecular formula C21H15Cl2N2O6S- and a molecular weight of 494.33 g/mol. Its IUPAC name is [3-chloro-4-[[4-chloro-3-(5-methoxycarbonyl-2-pyridinyl)phenyl]carbamoyl]phenyl]methyl sulfite.
| Compound Name | [3-chloro-4-[[4-chloro-3-(5-methoxycarbonyl-2-pyridinyl)phenyl]carbamoyl]phenyl]methyl sulfite |
|---|---|
| PubChem CID | 174713766 |
| Molecular Formula | C21H15Cl2N2O6S- |
| Molecular Weight | 494.33 g/mol |
| Exact Mass | 493.00 |
| IUPAC Name | [3-chloro-4-[[4-chloro-3-(5-methoxycarbonyl-2-pyridinyl)phenyl]carbamoyl]phenyl]methyl sulfite |
| SMILES | COC(=O)c1ccc(-c2cc(NC(=O)c3ccc(COS(=O)[O-])cc3Cl)ccc2Cl)nc1 |
| InChI | InChI=1S/C21H16Cl2N2O6S/c1-30-21(27)13-3-7-19(24-10-13)16-9-14(4-6-17(16)22)25-20(26)15-5-2-12(8-18(15)23)11-31-32(28)29/h2-10H,11H2,1H3,(H,25,26)(H,28,29)/p-1 |
| InChIKey | NIDQLDLTJKFXSC-UHFFFAOYSA-M |
| XLogP | 4.41 |
| TPSA | 117.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|