C23H17Cl2N3O3S — CID 59826557
2-chloro-N-(4-chloro-3-quinoxalin-2-ylphenyl)-4-(methylsulfonylmethyl)benzamide (PubChem CID 59826557) has the molecular formula C23H17Cl2N3O3S and a molecular weight of 486.38 g/mol. Its IUPAC name is 2-chloro-N-(4-chloro-3-quinoxalin-2-ylphenyl)-4-(methylsulfonylmethyl)benzamide.
| Compound Name | 2-chloro-N-(4-chloro-3-quinoxalin-2-ylphenyl)-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 59826557 |
| Molecular Formula | C23H17Cl2N3O3S |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | 2-chloro-N-(4-chloro-3-quinoxalin-2-ylphenyl)-4-(methylsulfonylmethyl)benzamide |
| SMILES | CS(=O)(=O)Cc1ccc(C(=O)Nc2ccc(Cl)c(-c3cnc4ccccc4n3)c2)c(Cl)c1 |
| InChI | InChI=1S/C23H17Cl2N3O3S/c1-32(30,31)13-14-6-8-16(19(25)10-14)23(29)27-15-7-9-18(24)17(11-15)22-12-26-20-4-2-3-5-21(20)28-22/h2-12H,13H2,1H3,(H,27,29) |
| InChIKey | RIGYHWWTMMPILM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |