C23H18Cl2N4O2S — CID 67987235
N-[3-chloro-4-[1-(4-chloro-3-quinoxalin-2-ylanilino)ethenyl]phenyl]methanesulfonamide (PubChem CID 67987235) has the molecular formula C23H18Cl2N4O2S and a molecular weight of 485.40 g/mol. Its IUPAC name is N-[3-chloro-4-[1-(4-chloro-3-quinoxalin-2-ylanilino)ethenyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-chloro-4-[1-(4-chloro-3-quinoxalin-2-ylanilino)ethenyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 67987235 |
| Molecular Formula | C23H18Cl2N4O2S |
| Molecular Weight | 485.40 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | N-[3-chloro-4-[1-(4-chloro-3-quinoxalin-2-ylanilino)ethenyl]phenyl]methanesulfonamide |
| SMILES | C=C(Nc1ccc(Cl)c(-c2cnc3ccccc3n2)c1)c1ccc(NS(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C23H18Cl2N4O2S/c1-14(17-9-7-16(12-20(17)25)29-32(2,30)31)27-15-8-10-19(24)18(11-15)23-13-26-21-5-3-4-6-22(21)28-23/h3-13,27,29H,1H2,2H3 |
| InChIKey | KNAZVFHQGIFZLY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.40 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |