C19H17NO3 — CID 174717725
[5-[4-[1-(hydroxymethyl)cyclopropyl]phenyl]-1H-indol-3-yl] formate (PubChem CID 174717725) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is [5-[4-[1-(hydroxymethyl)cyclopropyl]phenyl]-1H-indol-3-yl] formate.
| Compound Name | [5-[4-[1-(hydroxymethyl)cyclopropyl]phenyl]-1H-indol-3-yl] formate |
|---|---|
| PubChem CID | 174717725 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | [5-[4-[1-(hydroxymethyl)cyclopropyl]phenyl]-1H-indol-3-yl] formate |
| SMILES | O=COc1c[nH]c2ccc(-c3ccc(C4(CO)CC4)cc3)cc12 |
| InChI | InChI=1S/C19H17NO3/c21-11-19(7-8-19)15-4-1-13(2-5-15)14-3-6-17-16(9-14)18(10-20-17)23-12-22/h1-6,9-10,12,20-21H,7-8,11H2 |
| InChIKey | KKKKSFMPMVPQLE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|