About isothiocyanato 2-isothiocyanatobenzoate
isothiocyanato 2-isothiocyanatobenzoate (PubChem CID 174717763) has the molecular formula C9H4N2O2S2
and a molecular weight of 236.28 g/mol. Its IUPAC name is isothiocyanato 2-isothiocyanatobenzoate.
Molecular Properties
| Compound Name | isothiocyanato 2-isothiocyanatobenzoate |
| PubChem CID | 174717763 |
| Molecular Formula | C9H4N2O2S2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | isothiocyanato 2-isothiocyanatobenzoate |
| SMILES | O=C(ON=C=S)c1ccccc1N=C=S |
| InChI | InChI=1S/C9H4N2O2S2/c12-9(13-11-6-15)7-3-1-2-4-8(7)10-5-14/h1-4H |
| InChIKey | WOXJOFVMGKFOQK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze isothiocyanato 2-isothiocyanatobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isothiocyanato 2-isothiocyanatobenzoate?
The IUPAC name of isothiocyanato 2-isothiocyanatobenzoate (CID 174717763) is isothiocyanato 2-isothiocyanatobenzoate.
What is the SMILES notation for isothiocyanato 2-isothiocyanatobenzoate?
The canonical SMILES for isothiocyanato 2-isothiocyanatobenzoate is O=C(ON=C=S)c1ccccc1N=C=S.
What is the InChIKey of isothiocyanato 2-isothiocyanatobenzoate?
The InChIKey is WOXJOFVMGKFOQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4N2O2S2/c12-9(13-11-6-15)7-3-1-2-4-8(7)10-5-14/h1-4H.
What are the key properties of isothiocyanato 2-isothiocyanatobenzoate?
isothiocyanato 2-isothiocyanatobenzoate has a molecular weight of 236.28 g/mol, XLogP of 2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for isothiocyanato 2-isothiocyanatobenzoate is sourced from PubChem (CID 174717763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).