C17H12N2O4 — CID 174718277
1,8-dihydroxyanthracene-9,10-dione;1H-imidazole (PubChem CID 174718277) has the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. Its IUPAC name is 1,8-dihydroxyanthracene-9,10-dione;1H-imidazole.
| Compound Name | 1,8-dihydroxyanthracene-9,10-dione;1H-imidazole |
|---|---|
| PubChem CID | 174718277 |
| Molecular Formula | C17H12N2O4 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 1,8-dihydroxyanthracene-9,10-dione;1H-imidazole |
| SMILES | O=C1c2cccc(O)c2C(=O)c2c(O)cccc21.c1c[nH]cn1 |
| InChI | InChI=1S/C14H8O4.C3H4N2/c15-9-5-1-3-7-11(9)14(18)12-8(13(7)17)4-2-6-10(12)16;1-2-5-3-4-1/h1-6,15-16H;1-3H,(H,4,5) |
| InChIKey | QMTKJYUEMLYICQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|