C15H24N2O4 — CID 174719309
tert-butyl 2-(pyridin-2-ylmethylamino)acetate;ethyl formate (PubChem CID 174719309) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is tert-butyl 2-(pyridin-2-ylmethylamino)acetate;ethyl formate.
| Compound Name | tert-butyl 2-(pyridin-2-ylmethylamino)acetate;ethyl formate |
|---|---|
| PubChem CID | 174719309 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | tert-butyl 2-(pyridin-2-ylmethylamino)acetate;ethyl formate |
| SMILES | CC(C)(C)OC(=O)CNCc1ccccn1.CCOC=O |
| InChI | InChI=1S/C12H18N2O2.C3H6O2/c1-12(2,3)16-11(15)9-13-8-10-6-4-5-7-14-10;1-2-5-3-4/h4-7,13H,8-9H2,1-3H3;3H,2H2,1H3 |
| InChIKey | IGTTYGYRDVWELL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|