C19H26F3N3O — CID 174719406
1-[3-[2-[(3S)-3-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]ethyl]-2-pyridinyl]piperidine-2-carbaldehyde (PubChem CID 174719406) has the molecular formula C19H26F3N3O and a molecular weight of 369.43 g/mol. Its IUPAC name is 1-[3-[2-[(3S)-3-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]ethyl]-2-pyridinyl]piperidine-2-carbaldehyde.
| Compound Name | 1-[3-[2-[(3S)-3-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]ethyl]-2-pyridinyl]piperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174719406 |
| Molecular Formula | C19H26F3N3O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 1-[3-[2-[(3S)-3-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]ethyl]-2-pyridinyl]piperidine-2-carbaldehyde |
| SMILES | O=CC1CCCCN1c1ncccc1CCN1CC[C@@H](CC(F)(F)F)C1 |
| InChI | InChI=1S/C19H26F3N3O/c20-19(21,22)12-15-6-10-24(13-15)11-7-16-4-3-8-23-18(16)25-9-2-1-5-17(25)14-26/h3-4,8,14-15,17H,1-2,5-7,9-13H2/t15-,17?/m0/s1 |
| InChIKey | WQICPHNYKIJLRR-MYJWUSKBSA-N |
| XLogP | 3.46 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|