About 2-morpholin-3-ylpropyl formate
2-morpholin-3-ylpropyl formate (PubChem CID 174721455) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is 2-morpholin-3-ylpropyl formate.
Molecular Properties
| Compound Name | 2-morpholin-3-ylpropyl formate |
| PubChem CID | 174721455 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 2-morpholin-3-ylpropyl formate |
| SMILES | CC(COC=O)C1COCCN1 |
| InChI | InChI=1S/C8H15NO3/c1-7(4-12-6-10)8-5-11-3-2-9-8/h6-9H,2-5H2,1H3 |
| InChIKey | GRZJXASMIZTQIU-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-morpholin-3-ylpropyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-3-ylpropyl formate?
The IUPAC name of 2-morpholin-3-ylpropyl formate (CID 174721455) is 2-morpholin-3-ylpropyl formate.
What is the SMILES notation for 2-morpholin-3-ylpropyl formate?
The canonical SMILES for 2-morpholin-3-ylpropyl formate is CC(COC=O)C1COCCN1.
What is the InChIKey of 2-morpholin-3-ylpropyl formate?
The InChIKey is GRZJXASMIZTQIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c1-7(4-12-6-10)8-5-11-3-2-9-8/h6-9H,2-5H2,1H3.
What are the key properties of 2-morpholin-3-ylpropyl formate?
2-morpholin-3-ylpropyl formate has a molecular weight of 173.21 g/mol, XLogP of -0.22, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-3-ylpropyl formate is sourced from PubChem (CID 174721455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).