About 2-(azetidin-2-yl)propyl formate
2-(azetidin-2-yl)propyl formate (PubChem CID 174706434) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 2-(azetidin-2-yl)propyl formate.
Molecular Properties
| Compound Name | 2-(azetidin-2-yl)propyl formate |
| PubChem CID | 174706434 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 2-(azetidin-2-yl)propyl formate |
| SMILES | CC(COC=O)C1CCN1 |
| InChI | InChI=1S/C7H13NO2/c1-6(4-10-5-9)7-2-3-8-7/h5-8H,2-4H2,1H3 |
| InChIKey | JSOCPFYWVFSVBD-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(azetidin-2-yl)propyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azetidin-2-yl)propyl formate?
The IUPAC name of 2-(azetidin-2-yl)propyl formate (CID 174706434) is 2-(azetidin-2-yl)propyl formate.
What is the SMILES notation for 2-(azetidin-2-yl)propyl formate?
The canonical SMILES for 2-(azetidin-2-yl)propyl formate is CC(COC=O)C1CCN1.
What is the InChIKey of 2-(azetidin-2-yl)propyl formate?
The InChIKey is JSOCPFYWVFSVBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-6(4-10-5-9)7-2-3-8-7/h5-8H,2-4H2,1H3.
What are the key properties of 2-(azetidin-2-yl)propyl formate?
2-(azetidin-2-yl)propyl formate has a molecular weight of 143.19 g/mol, XLogP of 0.16, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azetidin-2-yl)propyl formate is sourced from PubChem (CID 174706434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).