C28H34N4O5 — CID 174722779
tert-butyl 2-[3-[4-(2,4-diaminophenyl)-3-(phenylmethoxycarbonylamino)-2-pyridinyl]propoxy]acetate (PubChem CID 174722779) has the molecular formula C28H34N4O5 and a molecular weight of 506.60 g/mol. Its IUPAC name is tert-butyl 2-[3-[4-(2,4-diaminophenyl)-3-(phenylmethoxycarbonylamino)-2-pyridinyl]propoxy]acetate.
| Compound Name | tert-butyl 2-[3-[4-(2,4-diaminophenyl)-3-(phenylmethoxycarbonylamino)-2-pyridinyl]propoxy]acetate |
|---|---|
| PubChem CID | 174722779 |
| Molecular Formula | C28H34N4O5 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | tert-butyl 2-[3-[4-(2,4-diaminophenyl)-3-(phenylmethoxycarbonylamino)-2-pyridinyl]propoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCCc1nccc(-c2ccc(N)cc2N)c1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H34N4O5/c1-28(2,3)37-25(33)18-35-15-7-10-24-26(32-27(34)36-17-19-8-5-4-6-9-19)22(13-14-31-24)21-12-11-20(29)16-23(21)30/h4-6,8-9,11-14,16H,7,10,15,17-18,29-30H2,1-3H3,(H,32,34) |
| InChIKey | QAAYDAZHDMKZAW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 138.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|