C15H16F3N3O2 — CID 174727937
3-amino-4-[5-[4-(trifluoromethoxy)phenyl]-1H-imidazol-2-yl]pentanal (PubChem CID 174727937) has the molecular formula C15H16F3N3O2 and a molecular weight of 327.31 g/mol. Its IUPAC name is 3-amino-4-[5-[4-(trifluoromethoxy)phenyl]-1H-imidazol-2-yl]pentanal.
| Compound Name | 3-amino-4-[5-[4-(trifluoromethoxy)phenyl]-1H-imidazol-2-yl]pentanal |
|---|---|
| PubChem CID | 174727937 |
| Molecular Formula | C15H16F3N3O2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 3-amino-4-[5-[4-(trifluoromethoxy)phenyl]-1H-imidazol-2-yl]pentanal |
| SMILES | CC(c1ncc(-c2ccc(OC(F)(F)F)cc2)[nH]1)C(N)CC=O |
| InChI | InChI=1S/C15H16F3N3O2/c1-9(12(19)6-7-22)14-20-8-13(21-14)10-2-4-11(5-3-10)23-15(16,17)18/h2-5,7-9,12H,6,19H2,1H3,(H,20,21) |
| InChIKey | DTDWYFFZFDSEAE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|