C15H18F3NO4 — CID 174728586
butoxycarbonyl 4-amino-4-(2,4,5-trifluorophenyl)butanoate (PubChem CID 174728586) has the molecular formula C15H18F3NO4 and a molecular weight of 333.31 g/mol. Its IUPAC name is butoxycarbonyl 4-amino-4-(2,4,5-trifluorophenyl)butanoate.
| Compound Name | butoxycarbonyl 4-amino-4-(2,4,5-trifluorophenyl)butanoate |
|---|---|
| PubChem CID | 174728586 |
| Molecular Formula | C15H18F3NO4 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | butoxycarbonyl 4-amino-4-(2,4,5-trifluorophenyl)butanoate |
| SMILES | CCCCOC(=O)OC(=O)CCC(N)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C15H18F3NO4/c1-2-3-6-22-15(21)23-14(20)5-4-13(19)9-7-11(17)12(18)8-10(9)16/h7-8,13H,2-6,19H2,1H3 |
| InChIKey | HNXRFVXDPFGNJK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|