cyclohexanamine;3-methyl-2-(octanoylamino)butanoic acid

C19H38N2O3 — CID 174729804

IUPACcyclohexanamine;3-methyl-2-(octanoylamino)butanoic acid
SMILESCCCCCCCC(=O)NC(C(=O)O)C(C)C.NC1CCCCC1
InChIInChI=1S/C13H25NO3.C6H13N/c1-4-5-6-7-8-9-11(15)14-12(10(2)3)13(16)17;7-6-4-2-1-3-5-6/h10,12H,4-9H2,1-3H3,(H,14,15)(H,16,17);6H,1-5,7H2
InChIKeyBSAHREWKBVMCQT-UHFFFAOYSA-N
MW342.52 g/mol
LogP3.85
Rot. Bonds9

About cyclohexanamine;3-methyl-2-(octanoylamino)butanoic acid

cyclohexanamine;3-methyl-2-(octanoylamino)butanoic acid (PubChem CID 174729804) has the molecular formula C19H38N2O3 and a molecular weight of 342.52 g/mol. Its IUPAC name is cyclohexanamine;3-methyl-2-(octanoylamino)butanoic acid.

Molecular Properties

Compound Namecyclohexanamine;3-methyl-2-(octanoylamino)butanoic acid
PubChem CID174729804
Molecular FormulaC19H38N2O3
Molecular Weight342.52 g/mol
Exact Mass342.29
IUPAC Namecyclohexanamine;3-methyl-2-(octanoylamino)butanoic acid
SMILESCCCCCCCC(=O)NC(C(=O)O)C(C)C.NC1CCCCC1
InChIInChI=1S/C13H25NO3.C6H13N/c1-4-5-6-7-8-9-11(15)14-12(10(2)3)13(16)17;7-6-4-2-1-3-5-6/h10,12H,4-9H2,1-3H3,(H,14,15)(H,16,17);6H,1-5,7H2
InChIKeyBSAHREWKBVMCQT-UHFFFAOYSA-N
XLogP3.85
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500342.52
LogP ≤ 53.85
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze cyclohexanamine;3-methyl-2-(octanoylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclohexanamine;3-methyl-2-(octanoylamino)butanoic acid?
The IUPAC name of cyclohexanamine;3-methyl-2-(octanoylamino)butanoic acid (CID 174729804) is cyclohexanamine;3-methyl-2-(octanoylamino)butanoic acid.
What is the SMILES notation for cyclohexanamine;3-methyl-2-(octanoylamino)butanoic acid?
The canonical SMILES for cyclohexanamine;3-methyl-2-(octanoylamino)butanoic acid is CCCCCCCC(=O)NC(C(=O)O)C(C)C.NC1CCCCC1.
What is the InChIKey of cyclohexanamine;3-methyl-2-(octanoylamino)butanoic acid?
The InChIKey is BSAHREWKBVMCQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3.C6H13N/c1-4-5-6-7-8-9-11(15)14-12(10(2)3)13(16)17;7-6-4-2-1-3-5-6/h10,12H,4-9H2,1-3H3,(H,14,15)(H,16,17);6H,1-5,7H2.
What are the key properties of cyclohexanamine;3-methyl-2-(octanoylamino)butanoic acid?
cyclohexanamine;3-methyl-2-(octanoylamino)butanoic acid has a molecular weight of 342.52 g/mol, XLogP of 3.85, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanamine;3-methyl-2-(octanoylamino)butanoic acid is sourced from PubChem (CID 174729804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).