C10H11NO3 — CID 174729973
[2-(4,6-dimethyl-3-pyridinyl)-2-oxoethyl] formate (PubChem CID 174729973) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is [2-(4,6-dimethyl-3-pyridinyl)-2-oxoethyl] formate.
| Compound Name | [2-(4,6-dimethyl-3-pyridinyl)-2-oxoethyl] formate |
|---|---|
| PubChem CID | 174729973 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | [2-(4,6-dimethyl-3-pyridinyl)-2-oxoethyl] formate |
| SMILES | Cc1cc(C)c(C(=O)COC=O)cn1 |
| InChI | InChI=1S/C10H11NO3/c1-7-3-8(2)11-4-9(7)10(13)5-14-6-12/h3-4,6H,5H2,1-2H3 |
| InChIKey | NDBANFQXCYZALO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|