C14H24N2O6S — CID 174730556
bis[2-methyl-1-(prop-2-enoylamino)propan-2-yl] sulfate (PubChem CID 174730556) has the molecular formula C14H24N2O6S and a molecular weight of 348.42 g/mol. Its IUPAC name is bis[2-methyl-1-(prop-2-enoylamino)propan-2-yl] sulfate.
| Compound Name | bis[2-methyl-1-(prop-2-enoylamino)propan-2-yl] sulfate |
|---|---|
| PubChem CID | 174730556 |
| Molecular Formula | C14H24N2O6S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | bis[2-methyl-1-(prop-2-enoylamino)propan-2-yl] sulfate |
| SMILES | C=CC(=O)NCC(C)(C)OS(=O)(=O)OC(C)(C)CNC(=O)C=C |
| InChI | InChI=1S/C14H24N2O6S/c1-7-11(17)15-9-13(3,4)21-23(19,20)22-14(5,6)10-16-12(18)8-2/h7-8H,1-2,9-10H2,3-6H3,(H,15,17)(H,16,18) |
| InChIKey | FKHLHNBHVWIATN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|