C11H18N2O5S — CID 87757557
1-(prop-2-enoylamino)-2-[(prop-2-enoylamino)methyl]butane-2-sulfonic acid (PubChem CID 87757557) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is 1-(prop-2-enoylamino)-2-[(prop-2-enoylamino)methyl]butane-2-sulfonic acid.
| Compound Name | 1-(prop-2-enoylamino)-2-[(prop-2-enoylamino)methyl]butane-2-sulfonic acid |
|---|---|
| PubChem CID | 87757557 |
| Molecular Formula | C11H18N2O5S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1-(prop-2-enoylamino)-2-[(prop-2-enoylamino)methyl]butane-2-sulfonic acid |
| SMILES | C=CC(=O)NCC(CC)(CNC(=O)C=C)S(=O)(=O)O |
| InChI | InChI=1S/C11H18N2O5S/c1-4-9(14)12-7-11(6-3,19(16,17)18)8-13-10(15)5-2/h4-5H,1-2,6-8H2,3H3,(H,12,14)(H,13,15)(H,16,17,18) |
| InChIKey | GRLZSRMADFXZHF-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|