C4H8NNaO4S — CID 173449632
sodium;hydride;(prop-2-enoylamino)methanesulfonic acid (PubChem CID 173449632) has the molecular formula C4H8NNaO4S and a molecular weight of 189.17 g/mol. Its IUPAC name is sodium;hydride;(prop-2-enoylamino)methanesulfonic acid.
| Compound Name | sodium;hydride;(prop-2-enoylamino)methanesulfonic acid |
|---|---|
| PubChem CID | 173449632 |
| Molecular Formula | C4H8NNaO4S |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.01 |
| IUPAC Name | sodium;hydride;(prop-2-enoylamino)methanesulfonic acid |
| SMILES | C=CC(=O)NCS(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C4H7NO4S.Na.H/c1-2-4(6)5-3-10(7,8)9;;/h2H,1,3H2,(H,5,6)(H,7,8,9);;/q;+1;-1 |
| InChIKey | ABKPSQWGGPXHQB-UHFFFAOYSA-N |
| XLogP | -3.75 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|