C24H47N2NaO4 — CID 174731938
sodium;hydride;2-hydroxyethyl-[2-[methyl-[(Z)-octadec-9-enoyl]amino]ethyl]carbamic acid (PubChem CID 174731938) has the molecular formula C24H47N2NaO4 and a molecular weight of 450.64 g/mol. Its IUPAC name is sodium;hydride;2-hydroxyethyl-[2-[methyl-[(Z)-octadec-9-enoyl]amino]ethyl]carbamic acid.
| Compound Name | sodium;hydride;2-hydroxyethyl-[2-[methyl-[(Z)-octadec-9-enoyl]amino]ethyl]carbamic acid |
|---|---|
| PubChem CID | 174731938 |
| Molecular Formula | C24H47N2NaO4 |
| Molecular Weight | 450.64 g/mol |
| Exact Mass | 450.34 |
| IUPAC Name | sodium;hydride;2-hydroxyethyl-[2-[methyl-[(Z)-octadec-9-enoyl]amino]ethyl]carbamic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N(C)CCN(CCO)C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C24H46N2O4.Na.H/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(28)25(2)19-20-26(21-22-27)24(29)30;;/h10-11,27H,3-9,12-22H2,1-2H3,(H,29,30);;/q;+1;-1/b11-10-;; |
| InChIKey | FJKMBXPPQOZQLZ-PQBRBDCOSA-N |
| XLogP | 2.57 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.64 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|