About sodium;(Z)-N-methyl-N-(2-sulfinatoethyl)octadec-9-enamide;hydroxide
sodium;(Z)-N-methyl-N-(2-sulfinatoethyl)octadec-9-enamide;hydroxide (PubChem CID 153439313) has the molecular formula C21H41NNaO4S-
and a molecular weight of 426.62 g/mol. Its IUPAC name is sodium;(Z)-N-methyl-N-(2-sulfinatoethyl)octadec-9-enamide;hydroxide.
Molecular Properties
| Compound Name | sodium;(Z)-N-methyl-N-(2-sulfinatoethyl)octadec-9-enamide;hydroxide |
| PubChem CID | 153439313 |
| Molecular Formula | C21H41NNaO4S- |
| Molecular Weight | 426.62 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | sodium;(Z)-N-methyl-N-(2-sulfinatoethyl)octadec-9-enamide;hydroxide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N(C)CC[S-](=O)=O.[Na+].[OH-] |
| InChI | InChI=1S/C21H40NO3S.Na.H2O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(23)22(2)19-20-26(24)25;;/h10-11H,3-9,12-20H2,1-2H3;;1H2/q-1;+1;/p-1/b11-10-;; |
| InChIKey | ZDNRMVLYQUUUSC-PQBRBDCOSA-M |
| XLogP | 2.62 |
| TPSA | 84.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.62 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;(Z)-N-methyl-N-(2-sulfinatoethyl)octadec-9-enamide;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;(Z)-N-methyl-N-(2-sulfinatoethyl)octadec-9-enamide;hydroxide?
The IUPAC name of sodium;(Z)-N-methyl-N-(2-sulfinatoethyl)octadec-9-enamide;hydroxide (CID 153439313) is sodium;(Z)-N-methyl-N-(2-sulfinatoethyl)octadec-9-enamide;hydroxide.
What is the SMILES notation for sodium;(Z)-N-methyl-N-(2-sulfinatoethyl)octadec-9-enamide;hydroxide?
The canonical SMILES for sodium;(Z)-N-methyl-N-(2-sulfinatoethyl)octadec-9-enamide;hydroxide is CCCCCCCC/C=C\CCCCCCCC(=O)N(C)CC[S-](=O)=O.[Na+].[OH-].
What is the InChIKey of sodium;(Z)-N-methyl-N-(2-sulfinatoethyl)octadec-9-enamide;hydroxide?
The InChIKey is ZDNRMVLYQUUUSC-PQBRBDCOSA-M. The full InChI is InChI=1S/C21H40NO3S.Na.H2O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(23)22(2)19-20-26(24)25;;/h10-11H,3-9,12-20H2,1-2H3;;1H2/q-1;+1;/p-1/b11-10-;;.
What are the key properties of sodium;(Z)-N-methyl-N-(2-sulfinatoethyl)octadec-9-enamide;hydroxide?
sodium;(Z)-N-methyl-N-(2-sulfinatoethyl)octadec-9-enamide;hydroxide has a molecular weight of 426.62 g/mol, XLogP of 2.62, 18 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;(Z)-N-methyl-N-(2-sulfinatoethyl)octadec-9-enamide;hydroxide is sourced from PubChem (CID 153439313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).