About 1-aminopyrrole-2,5-dione;N'-hydroxybutanediamide
1-aminopyrrole-2,5-dione;N'-hydroxybutanediamide (PubChem CID 174732201) has the molecular formula C8H12N4O5
and a molecular weight of 244.21 g/mol. Its IUPAC name is 1-aminopyrrole-2,5-dione;N'-hydroxybutanediamide.
Molecular Properties
| Compound Name | 1-aminopyrrole-2,5-dione;N'-hydroxybutanediamide |
| PubChem CID | 174732201 |
| Molecular Formula | C8H12N4O5 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-aminopyrrole-2,5-dione;N'-hydroxybutanediamide |
| SMILES | NC(=O)CCC(=O)NO.NN1C(=O)C=CC1=O |
| InChI | InChI=1S/C4H8N2O3.C4H4N2O2/c5-3(7)1-2-4(8)6-9;5-6-3(7)1-2-4(6)8/h9H,1-2H2,(H2,5,7)(H,6,8);1-2H,5H2 |
| InChIKey | OQGQIHIONDORJA-UHFFFAOYSA-N |
| XLogP | -2.46 |
| TPSA | 155.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopyrrole-2,5-dione;N'-hydroxybutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopyrrole-2,5-dione;N'-hydroxybutanediamide?
The IUPAC name of 1-aminopyrrole-2,5-dione;N'-hydroxybutanediamide (CID 174732201) is 1-aminopyrrole-2,5-dione;N'-hydroxybutanediamide.
What is the SMILES notation for 1-aminopyrrole-2,5-dione;N'-hydroxybutanediamide?
The canonical SMILES for 1-aminopyrrole-2,5-dione;N'-hydroxybutanediamide is NC(=O)CCC(=O)NO.NN1C(=O)C=CC1=O.
What is the InChIKey of 1-aminopyrrole-2,5-dione;N'-hydroxybutanediamide?
The InChIKey is OQGQIHIONDORJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O3.C4H4N2O2/c5-3(7)1-2-4(8)6-9;5-6-3(7)1-2-4(6)8/h9H,1-2H2,(H2,5,7)(H,6,8);1-2H,5H2.
What are the key properties of 1-aminopyrrole-2,5-dione;N'-hydroxybutanediamide?
1-aminopyrrole-2,5-dione;N'-hydroxybutanediamide has a molecular weight of 244.21 g/mol, XLogP of -2.46, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopyrrole-2,5-dione;N'-hydroxybutanediamide is sourced from PubChem (CID 174732201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).