C8H11N3O5 — CID 159614387
N'-hydroxybutanediamide;pyrrole-2,5-dione (PubChem CID 159614387) has the molecular formula C8H11N3O5 and a molecular weight of 229.19 g/mol. Its IUPAC name is N'-hydroxybutanediamide;pyrrole-2,5-dione.
| Compound Name | N'-hydroxybutanediamide;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 159614387 |
| Molecular Formula | C8H11N3O5 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | N'-hydroxybutanediamide;pyrrole-2,5-dione |
| SMILES | NC(=O)CCC(=O)NO.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C4H8N2O3.C4H3NO2/c5-3(7)1-2-4(8)6-9;6-3-1-2-4(7)5-3/h9H,1-2H2,(H2,5,7)(H,6,8);1-2H,(H,5,6,7) |
| InChIKey | MNCGYNOGBVXAEE-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|