C10H13N3O7 — CID 175240209
(2,5-dioxopyrrol-1-yl) acetate;N'-hydroxybutanediamide (PubChem CID 175240209) has the molecular formula C10H13N3O7 and a molecular weight of 287.23 g/mol. Its IUPAC name is (2,5-dioxopyrrol-1-yl) acetate;N'-hydroxybutanediamide.
| Compound Name | (2,5-dioxopyrrol-1-yl) acetate;N'-hydroxybutanediamide |
|---|---|
| PubChem CID | 175240209 |
| Molecular Formula | C10H13N3O7 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (2,5-dioxopyrrol-1-yl) acetate;N'-hydroxybutanediamide |
| SMILES | CC(=O)ON1C(=O)C=CC1=O.NC(=O)CCC(=O)NO |
| InChI | InChI=1S/C6H5NO4.C4H8N2O3/c1-4(8)11-7-5(9)2-3-6(7)10;5-3(7)1-2-4(8)6-9/h2-3H,1H3;9H,1-2H2,(H2,5,7)(H,6,8) |
| InChIKey | FESBGYLLPHQOOH-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 156.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|