C12H14N2O7 — CID 175381082
(2,5-dioxopyrrol-1-yl) butanoate;1-hydroxypyrrolidine-2,5-dione (PubChem CID 175381082) has the molecular formula C12H14N2O7 and a molecular weight of 298.25 g/mol. Its IUPAC name is (2,5-dioxopyrrol-1-yl) butanoate;1-hydroxypyrrolidine-2,5-dione.
| Compound Name | (2,5-dioxopyrrol-1-yl) butanoate;1-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 175381082 |
| Molecular Formula | C12H14N2O7 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | (2,5-dioxopyrrol-1-yl) butanoate;1-hydroxypyrrolidine-2,5-dione |
| SMILES | CCCC(=O)ON1C(=O)C=CC1=O.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C8H9NO4.C4H5NO3/c1-2-3-8(12)13-9-6(10)4-5-7(9)11;6-3-1-2-4(7)5(3)8/h4-5H,2-3H2,1H3;8H,1-2H2 |
| InChIKey | PLKYCLGKNKCBOB-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|