C12H14N2O6 — CID 139513214
(2,5-dioxopyrrolidin-1-yl) butanoate;pyrrole-2,5-dione (PubChem CID 139513214) has the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) butanoate;pyrrole-2,5-dione.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) butanoate;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 139513214 |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) butanoate;pyrrole-2,5-dione |
| SMILES | CCCC(=O)ON1C(=O)CCC1=O.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C8H11NO4.C4H3NO2/c1-2-3-8(12)13-9-6(10)4-5-7(9)11;6-3-1-2-4(7)5-3/h2-5H2,1H3;1-2H,(H,5,6,7) |
| InChIKey | UHHVFVWHKKSHEE-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|