C15H21N3O7 — CID 158073829
(2,5-dioxopyrrolidin-1-yl) acetate;3-(2,5-dioxopyrrol-1-yl)-N-methylpropanamide;methane (PubChem CID 158073829) has the molecular formula C15H21N3O7 and a molecular weight of 355.35 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) acetate;3-(2,5-dioxopyrrol-1-yl)-N-methylpropanamide;methane.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) acetate;3-(2,5-dioxopyrrol-1-yl)-N-methylpropanamide;methane |
|---|---|
| PubChem CID | 158073829 |
| Molecular Formula | C15H21N3O7 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) acetate;3-(2,5-dioxopyrrol-1-yl)-N-methylpropanamide;methane |
| SMILES | C.CC(=O)ON1C(=O)CCC1=O.CNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H10N2O3.C6H7NO4.CH4/c1-9-6(11)4-5-10-7(12)2-3-8(10)13;1-4(8)11-7-5(9)2-3-6(7)10;/h2-3H,4-5H2,1H3,(H,9,11);2-3H2,1H3;1H4 |
| InChIKey | FMDBUYFMBZJHRI-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|