C13H18N2O5 — CID 131730183
(2,5-dioxopyrrolidin-1-yl) prop-2-enoate;N-propan-2-ylprop-2-enamide (PubChem CID 131730183) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) prop-2-enoate;N-propan-2-ylprop-2-enamide.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) prop-2-enoate;N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 131730183 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) prop-2-enoate;N-propan-2-ylprop-2-enamide |
| SMILES | C=CC(=O)NC(C)C.C=CC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C7H7NO4.C6H11NO/c1-2-7(11)12-8-5(9)3-4-6(8)10;1-4-6(8)7-5(2)3/h2H,1,3-4H2;4-5H,1H2,2-3H3,(H,7,8) |
| InChIKey | VUQMXABROXOIPH-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|