C15H22N2O5 — CID 86597983
(2,5-dioxopyrrolidin-1-yl) 2-methylprop-2-enoate;2-methyl-N-propan-2-ylprop-2-enamide (PubChem CID 86597983) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-methylprop-2-enoate;2-methyl-N-propan-2-ylprop-2-enamide.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-methylprop-2-enoate;2-methyl-N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 86597983 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-methylprop-2-enoate;2-methyl-N-propan-2-ylprop-2-enamide |
| SMILES | C=C(C)C(=O)NC(C)C.C=C(C)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C8H9NO4.C7H13NO/c1-5(2)8(12)13-9-6(10)3-4-7(9)11;1-5(2)7(9)8-6(3)4/h1,3-4H2,2H3;6H,1H2,2-4H3,(H,8,9) |
| InChIKey | VUBRPVGVZNXSFD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|