C11H14N2O5 — CID 88585291
(2,5-dioxopyrrolidin-1-yl) 2-(2-methylprop-2-enoylamino)propanoate (PubChem CID 88585291) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-(2-methylprop-2-enoylamino)propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-(2-methylprop-2-enoylamino)propanoate |
|---|---|
| PubChem CID | 88585291 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-(2-methylprop-2-enoylamino)propanoate |
| SMILES | C=C(C)C(=O)NC(C)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C11H14N2O5/c1-6(2)10(16)12-7(3)11(17)18-13-8(14)4-5-9(13)15/h7H,1,4-5H2,2-3H3,(H,12,16) |
| InChIKey | SXELMFLHGWIWCN-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|