C12H16N2O5 — CID 89095990
(2,5-dioxopyrrolidin-1-yl) 4-(2-methylprop-2-enoylamino)butanoate (PubChem CID 89095990) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-(2-methylprop-2-enoylamino)butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-(2-methylprop-2-enoylamino)butanoate |
|---|---|
| PubChem CID | 89095990 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(2-methylprop-2-enoylamino)butanoate |
| SMILES | C=C(C)C(=O)NCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H16N2O5/c1-8(2)12(18)13-7-3-4-11(17)19-14-9(15)5-6-10(14)16/h1,3-7H2,2H3,(H,13,18) |
| InChIKey | XVNLRSKCQVQMKN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|