C10H16N2O4 — CID 155125828
1-hydroxypyrrolidine-2,5-dione;N-propan-2-ylprop-2-enamide (PubChem CID 155125828) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 1-hydroxypyrrolidine-2,5-dione;N-propan-2-ylprop-2-enamide.
| Compound Name | 1-hydroxypyrrolidine-2,5-dione;N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 155125828 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 1-hydroxypyrrolidine-2,5-dione;N-propan-2-ylprop-2-enamide |
| SMILES | C=CC(=O)NC(C)C.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C6H11NO.C4H5NO3/c1-4-6(8)7-5(2)3;6-3-1-2-4(7)5(3)8/h4-5H,1H2,2-3H3,(H,7,8);8H,1-2H2 |
| InChIKey | CCGOLZFJHKDIKD-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|