C7H8N2O4 — CID 174847714
N-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)prop-2-enamide (PubChem CID 174847714) has the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. Its IUPAC name is N-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)prop-2-enamide.
| Compound Name | N-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 174847714 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | N-(1-hydroxy-2,5-dioxopyrrolidin-3-yl)prop-2-enamide |
| SMILES | C=CC(=O)NC1CC(=O)N(O)C1=O |
| InChI | InChI=1S/C7H8N2O4/c1-2-5(10)8-4-3-6(11)9(13)7(4)12/h2,4,13H,1,3H2,(H,8,10) |
| InChIKey | MHUSAPVZLCHLDP-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|