C9H11N3O6 — CID 153336194
1-aminooxypyrrolidine-2,5-dione;1-methoxypyrrole-2,5-dione (PubChem CID 153336194) has the molecular formula C9H11N3O6 and a molecular weight of 257.20 g/mol. Its IUPAC name is 1-aminooxypyrrolidine-2,5-dione;1-methoxypyrrole-2,5-dione.
| Compound Name | 1-aminooxypyrrolidine-2,5-dione;1-methoxypyrrole-2,5-dione |
|---|---|
| PubChem CID | 153336194 |
| Molecular Formula | C9H11N3O6 |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 1-aminooxypyrrolidine-2,5-dione;1-methoxypyrrole-2,5-dione |
| SMILES | CON1C(=O)C=CC1=O.NON1C(=O)CCC1=O |
| InChI | InChI=1S/C5H5NO3.C4H6N2O3/c1-9-6-4(7)2-3-5(6)8;5-9-6-3(7)1-2-4(6)8/h2-3H,1H3;1-2,5H2 |
| InChIKey | NXVYPCVBCJFXEP-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|