C9H8N2O5 — CID 126595986
1-[(2,5-dioxopyrrolidin-1-yl)oxymethyl]pyrrole-2,5-dione (PubChem CID 126595986) has the molecular formula C9H8N2O5 and a molecular weight of 224.17 g/mol. Its IUPAC name is 1-[(2,5-dioxopyrrolidin-1-yl)oxymethyl]pyrrole-2,5-dione.
| Compound Name | 1-[(2,5-dioxopyrrolidin-1-yl)oxymethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 126595986 |
| Molecular Formula | C9H8N2O5 |
| Molecular Weight | 224.17 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 1-[(2,5-dioxopyrrolidin-1-yl)oxymethyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CON1C(=O)CCC1=O |
| InChI | InChI=1S/C9H8N2O5/c12-6-1-2-7(13)10(6)5-16-11-8(14)3-4-9(11)15/h1-2H,3-5H2 |
| InChIKey | WXTGHBMIODFJCQ-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.17 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|