C15H18N2O6 — CID 169179301
2-[(2,5-dioxopyrrolidin-1-yl)oxymethyl]-6-(2,5-dioxopyrrol-1-yl)hexanal (PubChem CID 169179301) has the molecular formula C15H18N2O6 and a molecular weight of 322.32 g/mol. Its IUPAC name is 2-[(2,5-dioxopyrrolidin-1-yl)oxymethyl]-6-(2,5-dioxopyrrol-1-yl)hexanal.
| Compound Name | 2-[(2,5-dioxopyrrolidin-1-yl)oxymethyl]-6-(2,5-dioxopyrrol-1-yl)hexanal |
|---|---|
| PubChem CID | 169179301 |
| Molecular Formula | C15H18N2O6 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 2-[(2,5-dioxopyrrolidin-1-yl)oxymethyl]-6-(2,5-dioxopyrrol-1-yl)hexanal |
| SMILES | O=CC(CCCCN1C(=O)C=CC1=O)CON1C(=O)CCC1=O |
| InChI | InChI=1S/C15H18N2O6/c18-9-11(10-23-17-14(21)6-7-15(17)22)3-1-2-8-16-12(19)4-5-13(16)20/h4-5,9,11H,1-3,6-8,10H2 |
| InChIKey | DREAXUNBHGTTSY-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|