C9H6N2O6Y-2 — CID 144791109
1-(oxomethoxy)pyrrolidine-2,5-dione;pyrrol-1-ide-2,5-dione;yttrium (PubChem CID 144791109) has the molecular formula C9H6N2O6Y-2 and a molecular weight of 327.06 g/mol. Its IUPAC name is 1-(oxomethoxy)pyrrolidine-2,5-dione;pyrrol-1-ide-2,5-dione;yttrium.
| Compound Name | 1-(oxomethoxy)pyrrolidine-2,5-dione;pyrrol-1-ide-2,5-dione;yttrium |
|---|---|
| PubChem CID | 144791109 |
| Molecular Formula | C9H6N2O6Y-2 |
| Molecular Weight | 327.06 g/mol |
| Exact Mass | 326.93 |
| IUPAC Name | 1-(oxomethoxy)pyrrolidine-2,5-dione;pyrrol-1-ide-2,5-dione;yttrium |
| SMILES | O=C1C=CC(=O)[N-]1.O=[C-]ON1C(=O)CCC1=O.[Y] |
| InChI | InChI=1S/C5H4NO4.C4H3NO2.Y/c7-3-10-6-4(8)1-2-5(6)9;6-3-1-2-4(7)5-3;/h1-2H2;1-2H,(H,5,6,7);/q-1;;/p-1 |
| InChIKey | VJIVAHIONZTSLI-UHFFFAOYSA-M |
| XLogP | -0.89 |
| TPSA | 111.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.06 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|