C9H6N2O7S2 — CID 143282311
(2,5-dioxopyrrolidin-1-yl) [(2,5-dioxopyrrol-1-yl)disulfanyl] carbonate (PubChem CID 143282311) has the molecular formula C9H6N2O7S2 and a molecular weight of 318.29 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) [(2,5-dioxopyrrol-1-yl)disulfanyl] carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) [(2,5-dioxopyrrol-1-yl)disulfanyl] carbonate |
|---|---|
| PubChem CID | 143282311 |
| Molecular Formula | C9H6N2O7S2 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) [(2,5-dioxopyrrol-1-yl)disulfanyl] carbonate |
| SMILES | O=C(OSSN1C(=O)C=CC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C9H6N2O7S2/c12-5-1-2-6(13)10(5)17-9(16)18-20-19-11-7(14)3-4-8(11)15/h3-4H,1-2H2 |
| InChIKey | BWGGBTZSBCXYKF-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|