C14H18N2O6 — CID 143979128
(2,5-dioxopyrrolidin-1-yl) 2-methylpentanoate;pyrrole-2,5-dione (PubChem CID 143979128) has the molecular formula C14H18N2O6 and a molecular weight of 310.31 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-methylpentanoate;pyrrole-2,5-dione.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-methylpentanoate;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 143979128 |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-methylpentanoate;pyrrole-2,5-dione |
| SMILES | CCCC(C)C(=O)ON1C(=O)CCC1=O.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C10H15NO4.C4H3NO2/c1-3-4-7(2)10(14)15-11-8(12)5-6-9(11)13;6-3-1-2-4(7)5-3/h7H,3-6H2,1-2H3;1-2H,(H,5,6,7) |
| InChIKey | KMHOPWYUFCTMDY-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|