C20H27N3O7 — CID 134467159
(2,5-dioxopyrrolidin-1-yl) 4-[[4-(2,5-dioxopyrrol-1-yl)-2-methylpentanoyl]amino]-2-methylpentanoate (PubChem CID 134467159) has the molecular formula C20H27N3O7 and a molecular weight of 421.45 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[[4-(2,5-dioxopyrrol-1-yl)-2-methylpentanoyl]amino]-2-methylpentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[[4-(2,5-dioxopyrrol-1-yl)-2-methylpentanoyl]amino]-2-methylpentanoate |
|---|---|
| PubChem CID | 134467159 |
| Molecular Formula | C20H27N3O7 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[[4-(2,5-dioxopyrrol-1-yl)-2-methylpentanoyl]amino]-2-methylpentanoate |
| SMILES | CC(CC(C)C(=O)ON1C(=O)CCC1=O)NC(=O)C(C)CC(C)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C20H27N3O7/c1-11(10-14(4)22-15(24)5-6-16(22)25)19(28)21-13(3)9-12(2)20(29)30-23-17(26)7-8-18(23)27/h5-6,11-14H,7-10H2,1-4H3,(H,21,28) |
| InChIKey | VBTMSUUOMCCYBG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|