C18H23N3O7 — CID 88533863
(3-methyl-2,5-dioxopyrrolidin-1-yl) 6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoate (PubChem CID 88533863) has the molecular formula C18H23N3O7 and a molecular weight of 393.40 g/mol. Its IUPAC name is (3-methyl-2,5-dioxopyrrolidin-1-yl) 6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoate.
| Compound Name | (3-methyl-2,5-dioxopyrrolidin-1-yl) 6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoate |
|---|---|
| PubChem CID | 88533863 |
| Molecular Formula | C18H23N3O7 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (3-methyl-2,5-dioxopyrrolidin-1-yl) 6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoate |
| SMILES | CC1CC(=O)N(OC(=O)CCCCCNC(=O)CCN2C(=O)C=CC2=O)C1=O |
| InChI | InChI=1S/C18H23N3O7/c1-12-11-16(25)21(18(12)27)28-17(26)5-3-2-4-9-19-13(22)8-10-20-14(23)6-7-15(20)24/h6-7,12H,2-5,8-11H2,1H3,(H,19,22) |
| InChIKey | WVVIBPCMMYZHAI-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|