C17H21N3O7 — CID 87735328
[[2-(2,5-dioxopyrrolidin-1-yl)-3-(2,5-dioxopyrrol-1-yl)propanoyl]amino] hexanoate (PubChem CID 87735328) has the molecular formula C17H21N3O7 and a molecular weight of 379.37 g/mol. Its IUPAC name is [[2-(2,5-dioxopyrrolidin-1-yl)-3-(2,5-dioxopyrrol-1-yl)propanoyl]amino] hexanoate.
| Compound Name | [[2-(2,5-dioxopyrrolidin-1-yl)-3-(2,5-dioxopyrrol-1-yl)propanoyl]amino] hexanoate |
|---|---|
| PubChem CID | 87735328 |
| Molecular Formula | C17H21N3O7 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | [[2-(2,5-dioxopyrrolidin-1-yl)-3-(2,5-dioxopyrrol-1-yl)propanoyl]amino] hexanoate |
| SMILES | CCCCCC(=O)ONC(=O)C(CN1C(=O)C=CC1=O)N1C(=O)CCC1=O |
| InChI | InChI=1S/C17H21N3O7/c1-2-3-4-5-16(25)27-18-17(26)11(20-14(23)8-9-15(20)24)10-19-12(21)6-7-13(19)22/h6-7,11H,2-5,8-10H2,1H3,(H,18,26) |
| InChIKey | KQRFCQNHIUBJFU-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|