C19H23N7O8 — CID 44548119
(2,5-dioxopyrrolidin-1-yl) (2S)-6-[(2-azidoacetyl)amino]-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoate (PubChem CID 44548119) has the molecular formula C19H23N7O8 and a molecular weight of 477.43 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2S)-6-[(2-azidoacetyl)amino]-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2S)-6-[(2-azidoacetyl)amino]-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoate |
|---|---|
| PubChem CID | 44548119 |
| Molecular Formula | C19H23N7O8 |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2S)-6-[(2-azidoacetyl)amino]-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoate |
| SMILES | [N-]=[N+]=NCC(=O)NCCCC[C@H](NC(=O)CCN1C(=O)C=CC1=O)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C19H23N7O8/c20-24-22-11-14(28)21-9-2-1-3-12(19(33)34-26-17(31)6-7-18(26)32)23-13(27)8-10-25-15(29)4-5-16(25)30/h4-5,12H,1-3,6-11H2,(H,21,28)(H,23,27)/t12-/m0/s1 |
| InChIKey | DUJPGNGCGFZQHK-LBPRGKRZSA-N |
| XLogP | -1.01 |
| TPSA | 208.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|