C15H20N6O6 — CID 59248166
(2S)-6-[(2-azidoacetyl)amino]-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoic acid (PubChem CID 59248166) has the molecular formula C15H20N6O6 and a molecular weight of 380.36 g/mol. Its IUPAC name is (2S)-6-[(2-azidoacetyl)amino]-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoic acid.
| Compound Name | (2S)-6-[(2-azidoacetyl)amino]-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 59248166 |
| Molecular Formula | C15H20N6O6 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (2S)-6-[(2-azidoacetyl)amino]-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoic acid |
| SMILES | [N-]=[N+]=NCC(=O)NCCCC[C@H](NC(=O)CCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C15H20N6O6/c16-20-18-9-12(23)17-7-2-1-3-10(15(26)27)19-11(22)6-8-21-13(24)4-5-14(21)25/h4-5,10H,1-3,6-9H2,(H,17,23)(H,19,22)(H,26,27)/t10-/m0/s1 |
| InChIKey | MZKCHVVVSCKBEX-JTQLQIEISA-N |
| XLogP | -0.53 |
| TPSA | 181.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|