About N'-hexanoyl-N'-hydroxybutanediamide;pyrrole-2,5-dione
N'-hexanoyl-N'-hydroxybutanediamide;pyrrole-2,5-dione (PubChem CID 174723922) has the molecular formula C14H21N3O6
and a molecular weight of 327.34 g/mol. Its IUPAC name is N'-hexanoyl-N'-hydroxybutanediamide;pyrrole-2,5-dione.
Molecular Properties
| Compound Name | N'-hexanoyl-N'-hydroxybutanediamide;pyrrole-2,5-dione |
| PubChem CID | 174723922 |
| Molecular Formula | C14H21N3O6 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N'-hexanoyl-N'-hydroxybutanediamide;pyrrole-2,5-dione |
| SMILES | CCCCCC(=O)N(O)C(=O)CCC(N)=O.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C10H18N2O4.C4H3NO2/c1-2-3-4-5-9(14)12(16)10(15)7-6-8(11)13;6-3-1-2-4(7)5-3/h16H,2-7H2,1H3,(H2,11,13);1-2H,(H,5,6,7) |
| InChIKey | YECDCZHPIGFEPZ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N'-hexanoyl-N'-hydroxybutanediamide;pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hexanoyl-N'-hydroxybutanediamide;pyrrole-2,5-dione?
The IUPAC name of N'-hexanoyl-N'-hydroxybutanediamide;pyrrole-2,5-dione (CID 174723922) is N'-hexanoyl-N'-hydroxybutanediamide;pyrrole-2,5-dione.
What is the SMILES notation for N'-hexanoyl-N'-hydroxybutanediamide;pyrrole-2,5-dione?
The canonical SMILES for N'-hexanoyl-N'-hydroxybutanediamide;pyrrole-2,5-dione is CCCCCC(=O)N(O)C(=O)CCC(N)=O.O=C1C=CC(=O)N1.
What is the InChIKey of N'-hexanoyl-N'-hydroxybutanediamide;pyrrole-2,5-dione?
The InChIKey is YECDCZHPIGFEPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O4.C4H3NO2/c1-2-3-4-5-9(14)12(16)10(15)7-6-8(11)13;6-3-1-2-4(7)5-3/h16H,2-7H2,1H3,(H2,11,13);1-2H,(H,5,6,7).
What are the key properties of N'-hexanoyl-N'-hydroxybutanediamide;pyrrole-2,5-dione?
N'-hexanoyl-N'-hydroxybutanediamide;pyrrole-2,5-dione has a molecular weight of 327.34 g/mol, XLogP of -0.22, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hexanoyl-N'-hydroxybutanediamide;pyrrole-2,5-dione is sourced from PubChem (CID 174723922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).