C14H19N3O6 — CID 87602445
N'-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]-N'-hydroxybutanediamide (PubChem CID 87602445) has the molecular formula C14H19N3O6 and a molecular weight of 325.32 g/mol. Its IUPAC name is N'-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]-N'-hydroxybutanediamide.
| Compound Name | N'-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]-N'-hydroxybutanediamide |
|---|---|
| PubChem CID | 87602445 |
| Molecular Formula | C14H19N3O6 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | N'-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]-N'-hydroxybutanediamide |
| SMILES | NC(=O)CCC(=O)N(O)C(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H19N3O6/c15-10(18)5-6-14(22)17(23)13(21)4-2-1-3-9-16-11(19)7-8-12(16)20/h7-8,23H,1-6,9H2,(H2,15,18) |
| InChIKey | RVSXRZFLZUXIIS-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 138.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|